About N-methoxy-1-(2,4,6-trifluorophenyl)methanamine
N-methoxy-1-(2,4,6-trifluorophenyl)methanamine (PubChem CID 147218980) has the molecular formula C8H8F3NO
and a molecular weight of 191.15 g/mol. Its IUPAC name is N-methoxy-1-(2,4,6-trifluorophenyl)methanamine.
Molecular Properties
| Compound Name | N-methoxy-1-(2,4,6-trifluorophenyl)methanamine |
| PubChem CID | 147218980 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | N-methoxy-1-(2,4,6-trifluorophenyl)methanamine |
| SMILES | CONCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C8H8F3NO/c1-13-12-4-6-7(10)2-5(9)3-8(6)11/h2-3,12H,4H2,1H3 |
| InChIKey | CGRNKQOGAADCAF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-1-(2,4,6-trifluorophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-1-(2,4,6-trifluorophenyl)methanamine?
The IUPAC name of N-methoxy-1-(2,4,6-trifluorophenyl)methanamine (CID 147218980) is N-methoxy-1-(2,4,6-trifluorophenyl)methanamine.
What is the SMILES notation for N-methoxy-1-(2,4,6-trifluorophenyl)methanamine?
The canonical SMILES for N-methoxy-1-(2,4,6-trifluorophenyl)methanamine is CONCc1c(F)cc(F)cc1F.
What is the InChIKey of N-methoxy-1-(2,4,6-trifluorophenyl)methanamine?
The InChIKey is CGRNKQOGAADCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO/c1-13-12-4-6-7(10)2-5(9)3-8(6)11/h2-3,12H,4H2,1H3.
What are the key properties of N-methoxy-1-(2,4,6-trifluorophenyl)methanamine?
N-methoxy-1-(2,4,6-trifluorophenyl)methanamine has a molecular weight of 191.15 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-1-(2,4,6-trifluorophenyl)methanamine is sourced from PubChem (CID 147218980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).