C19H22 — CID 147219193
12-methyl-1,2,3,4,5,6,11,12-octahydrochrysene (PubChem CID 147219193) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 12-methyl-1,2,3,4,5,6,11,12-octahydrochrysene.
| Compound Name | 12-methyl-1,2,3,4,5,6,11,12-octahydrochrysene |
|---|---|
| PubChem CID | 147219193 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 12-methyl-1,2,3,4,5,6,11,12-octahydrochrysene |
| SMILES | CC1CC2=C(CCc3ccccc32)C2=C1CCCC2 |
| InChI | InChI=1S/C19H22/c1-13-12-19-16-8-3-2-6-14(16)10-11-18(19)17-9-5-4-7-15(13)17/h2-3,6,8,13H,4-5,7,9-12H2,1H3 |
| InChIKey | VUGYIXQONLEHTJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |