About 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one (PubChem CID 14721965) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one |
| PubChem CID | 14721965 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1CC1=NCCN1 |
| InChI | InChI=1S/C8H13N3O/c12-8-2-1-5-11(8)6-7-9-3-4-10-7/h1-6H2,(H,9,10) |
| InChIKey | FACSTEMTDFHPCQ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one (CID 14721965) is 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one is O=C1CCCN1CC1=NCCN1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one?
The InChIKey is FACSTEMTDFHPCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c12-8-2-1-5-11(8)6-7-9-3-4-10-7/h1-6H2,(H,9,10).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one?
1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one has a molecular weight of 167.21 g/mol, XLogP of -0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 14721965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).