C15H19ClF3N5O — CID 147219903
6-butan-2-yl-5-chloro-3-[(Z)-methoxyiminomethyl]-N-(1,1,1-trifluoropropan-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 147219903) has the molecular formula C15H19ClF3N5O and a molecular weight of 377.80 g/mol. Its IUPAC name is 6-butan-2-yl-5-chloro-3-[(Z)-methoxyiminomethyl]-N-(1,1,1-trifluoropropan-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-butan-2-yl-5-chloro-3-[(Z)-methoxyiminomethyl]-N-(1,1,1-trifluoropropan-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 147219903 |
| Molecular Formula | C15H19ClF3N5O |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 6-butan-2-yl-5-chloro-3-[(Z)-methoxyiminomethyl]-N-(1,1,1-trifluoropropan-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCC(C)c1c(Cl)nc2c(/C=N\OC)cnn2c1NC(C)C(F)(F)F |
| InChI | InChI=1S/C15H19ClF3N5O/c1-5-8(2)11-12(16)23-13-10(7-21-25-4)6-20-24(13)14(11)22-9(3)15(17,18)19/h6-9,22H,5H2,1-4H3/b21-7- |
| InChIKey | CGVZAMROCRROSY-YXSASFKJSA-N |
| XLogP | 4.24 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|