About (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide
(Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide (PubChem CID 1472222) has the molecular formula C17H16Cl2N2O4S
and a molecular weight of 415.30 g/mol. Its IUPAC name is (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide.
Molecular Properties
| Compound Name | (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
| PubChem CID | 1472222 |
| Molecular Formula | C17H16Cl2N2O4S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide |
| SMILES | COc1ccc(CS(=O)/C(Cl)=C(/Cl)C(=O)Nc2ccc(OC)nc2)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O4S/c1-24-13-6-3-11(4-7-13)10-26(23)16(19)15(18)17(22)21-12-5-8-14(25-2)20-9-12/h3-9H,10H2,1-2H3,(H,21,22)/b16-15+ |
| InChIKey | SFXGKNBNDTZBEW-FOCLMDBBSA-N |
| XLogP | 3.63 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide?
The IUPAC name of (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide (CID 1472222) is (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide.
What is the SMILES notation for (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide?
The canonical SMILES for (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide is COc1ccc(CS(=O)/C(Cl)=C(/Cl)C(=O)Nc2ccc(OC)nc2)cc1.
What is the InChIKey of (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide?
The InChIKey is SFXGKNBNDTZBEW-FOCLMDBBSA-N. The full InChI is InChI=1S/C17H16Cl2N2O4S/c1-24-13-6-3-11(4-7-13)10-26(23)16(19)15(18)17(22)21-12-5-8-14(25-2)20-9-12/h3-9H,10H2,1-2H3,(H,21,22)/b16-15+.
What are the key properties of (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide?
(Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide has a molecular weight of 415.30 g/mol, XLogP of 3.63, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dichloro-3-[(4-methoxyphenyl)methylsulfinyl]-N-(6-methoxy-3-pyridinyl)prop-2-enamide is sourced from PubChem (CID 1472222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).