C25H29N5O3S — CID 147234724
3-methoxy-N-[3-[2-(methylamino)ethylamino]propyl]-4-oxo-5-(pyridin-2-ylmethyl)thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 147234724) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 3-methoxy-N-[3-[2-(methylamino)ethylamino]propyl]-4-oxo-5-(pyridin-2-ylmethyl)thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 3-methoxy-N-[3-[2-(methylamino)ethylamino]propyl]-4-oxo-5-(pyridin-2-ylmethyl)thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 147234724 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-methoxy-N-[3-[2-(methylamino)ethylamino]propyl]-4-oxo-5-(pyridin-2-ylmethyl)thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CNCCNCCCNC(=O)c1sc2c(c1OC)c(=O)n(Cc1ccccn1)c1ccccc21 |
| InChI | InChI=1S/C25H29N5O3S/c1-26-14-15-27-11-7-13-29-24(31)23-21(33-2)20-22(34-23)18-9-3-4-10-19(18)30(25(20)32)16-17-8-5-6-12-28-17/h3-6,8-10,12,26-27H,7,11,13-16H2,1-2H3,(H,29,31) |
| InChIKey | CJPACWOETMDFBR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|