C17H17N4NaO5 — CID 147234946
sodium (2R,3R,6E)-3-(methanimidoylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 147234946) has the molecular formula C17H17N4NaO5 and a molecular weight of 380.34 g/mol. Its IUPAC name is sodium (2R,3R,6E)-3-(methanimidoylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2R,3R,6E)-3-(methanimidoylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 147234946 |
| Molecular Formula | C17H17N4NaO5 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | sodium (2R,3R,6E)-3-(methanimidoylcarbamoyloxymethyl)-3-methyl-7-oxo-6-(pyridin-2-ylmethylidene)-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | [H]/N=C/NC(=O)OC[C@]1(C)CC2/C(=C\c3ccccn3)C(=O)N2[C@H]1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H18N4O5.Na/c1-17(8-26-16(25)20-9-18)7-12-11(6-10-4-2-3-5-19-10)14(22)21(12)13(17)15(23)24;/h2-6,9,12-13H,7-8H2,1H3,(H,23,24)(H2,18,20,25);/q;+1/p-1/b11-6+;/t12?,13-,17-;/m0./s1 |
| InChIKey | CJQBSTAMRPGYOB-NTQLMTBPSA-M |
| XLogP | -3.46 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|