C13H24N2O2 — CID 14723641
(2R)-2-amino-N-(2,2,4,4-tetramethyl-3-oxocyclobutyl)pentanamide (PubChem CID 14723641) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,2,4,4-tetramethyl-3-oxocyclobutyl)pentanamide.
| Compound Name | (2R)-2-amino-N-(2,2,4,4-tetramethyl-3-oxocyclobutyl)pentanamide |
|---|---|
| PubChem CID | 14723641 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (2R)-2-amino-N-(2,2,4,4-tetramethyl-3-oxocyclobutyl)pentanamide |
| SMILES | CCC[C@@H](N)C(=O)NC1C(C)(C)C(=O)C1(C)C |
| InChI | InChI=1S/C13H24N2O2/c1-6-7-8(14)9(16)15-10-12(2,3)11(17)13(10,4)5/h8,10H,6-7,14H2,1-5H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | GFPXRTGPFNVBTI-MRVPVSSYSA-N |
| XLogP | 1.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |