C15H14N2O4 — CID 147237842
3-(2,4-dioxocyclohexyl)-5-methyl-1H-quinazoline-2,4-dione (PubChem CID 147237842) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-(2,4-dioxocyclohexyl)-5-methyl-1H-quinazoline-2,4-dione.
| Compound Name | 3-(2,4-dioxocyclohexyl)-5-methyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 147237842 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-(2,4-dioxocyclohexyl)-5-methyl-1H-quinazoline-2,4-dione |
| SMILES | Cc1cccc2[nH]c(=O)n(C3CCC(=O)CC3=O)c(=O)c12 |
| InChI | InChI=1S/C15H14N2O4/c1-8-3-2-4-10-13(8)14(20)17(15(21)16-10)11-6-5-9(18)7-12(11)19/h2-4,11H,5-7H2,1H3,(H,16,21) |
| InChIKey | CKEKOMNHXQKGRA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|