C29H30F2N4O4 — CID 14723877
ethyl (6E,8E)-11,11-bis(4-fluorophenyl)-5-hydroxy-3-oxo-10-(1-propan-2-yltetrazol-5-yl)undeca-6,8,10-trienoate (PubChem CID 14723877) has the molecular formula C29H30F2N4O4 and a molecular weight of 536.58 g/mol. Its IUPAC name is ethyl (6E,8E)-11,11-bis(4-fluorophenyl)-5-hydroxy-3-oxo-10-(1-propan-2-yltetrazol-5-yl)undeca-6,8,10-trienoate.
| Compound Name | ethyl (6E,8E)-11,11-bis(4-fluorophenyl)-5-hydroxy-3-oxo-10-(1-propan-2-yltetrazol-5-yl)undeca-6,8,10-trienoate |
|---|---|
| PubChem CID | 14723877 |
| Molecular Formula | C29H30F2N4O4 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | ethyl (6E,8E)-11,11-bis(4-fluorophenyl)-5-hydroxy-3-oxo-10-(1-propan-2-yltetrazol-5-yl)undeca-6,8,10-trienoate |
| SMILES | CCOC(=O)CC(=O)CC(O)/C=C/C=C/C(=C(c1ccc(F)cc1)c1ccc(F)cc1)c1nnnn1C(C)C |
| InChI | InChI=1S/C29H30F2N4O4/c1-4-39-27(38)18-25(37)17-24(36)7-5-6-8-26(29-32-33-34-35(29)19(2)3)28(20-9-13-22(30)14-10-20)21-11-15-23(31)16-12-21/h5-16,19,24,36H,4,17-18H2,1-3H3/b7-5+,8-6+ |
| InChIKey | XYUNIKJBFRGYOZ-KQQUZDAGSA-N |
| XLogP | 4.88 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|