About 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal
3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal (PubChem CID 14723948) has the molecular formula C21H22N4O
and a molecular weight of 346.43 g/mol. Its IUPAC name is 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal.
Molecular Properties
| Compound Name | 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal |
| PubChem CID | 14723948 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal |
| SMILES | Cc1ccc(C(=C(C=O)c2nnnn2C)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H22N4O/c1-13-6-8-17(15(3)10-13)20(18-9-7-14(2)11-16(18)4)19(12-26)21-22-23-24-25(21)5/h6-12H,1-5H3 |
| InChIKey | GNFSQHYVQLUSTB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal?
The IUPAC name of 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal (CID 14723948) is 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal.
What is the SMILES notation for 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal?
The canonical SMILES for 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal is Cc1ccc(C(=C(C=O)c2nnnn2C)c2ccc(C)cc2C)c(C)c1.
What is the InChIKey of 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal?
The InChIKey is GNFSQHYVQLUSTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O/c1-13-6-8-17(15(3)10-13)20(18-9-7-14(2)11-16(18)4)19(12-26)21-22-23-24-25(21)5/h6-12H,1-5H3.
What are the key properties of 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal?
3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal has a molecular weight of 346.43 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(2,4-dimethylphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal is sourced from PubChem (CID 14723948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).