C20H22BF3N4O9 — CID 147239914
(3R)-3-[[(2S,3S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4,4,4-trifluoro-3-hydroxybutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 147239914) has the molecular formula C20H22BF3N4O9 and a molecular weight of 530.22 g/mol. Its IUPAC name is (3R)-3-[[(2S,3S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4,4,4-trifluoro-3-hydroxybutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2S,3S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4,4,4-trifluoro-3-hydroxybutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 147239914 |
| Molecular Formula | C20H22BF3N4O9 |
| Molecular Weight | 530.22 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (3R)-3-[[(2S,3S)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-4,4,4-trifluoro-3-hydroxybutanoyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)N[C@H](C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)[C@H](O)C(F)(F)F)C(=O)C1=O |
| InChI | InChI=1S/C20H22BF3N4O9/c1-2-27-6-7-28(17(32)16(27)31)19(35)26-12(14(29)20(22,23)24)15(30)25-11-8-9-4-3-5-10(18(33)34)13(9)37-21(11)36/h3-5,11-12,14,29,36H,2,6-8H2,1H3,(H,25,30)(H,26,35)(H,33,34)/t11-,12-,14-/m0/s1 |
| InChIKey | CKOIZTXVZUCKBM-OBJOEFQTSA-N |
| XLogP | -1.48 |
| TPSA | 185.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.22 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|