C19H15FN4O — CID 14724027
(2E,4E)-5-(4-fluorophenyl)-4-(1-methyltetrazol-5-yl)-5-phenylpenta-2,4-dienal (PubChem CID 14724027) has the molecular formula C19H15FN4O and a molecular weight of 334.35 g/mol. Its IUPAC name is (2E,4E)-5-(4-fluorophenyl)-4-(1-methyltetrazol-5-yl)-5-phenylpenta-2,4-dienal.
| Compound Name | (2E,4E)-5-(4-fluorophenyl)-4-(1-methyltetrazol-5-yl)-5-phenylpenta-2,4-dienal |
|---|---|
| PubChem CID | 14724027 |
| Molecular Formula | C19H15FN4O |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (2E,4E)-5-(4-fluorophenyl)-4-(1-methyltetrazol-5-yl)-5-phenylpenta-2,4-dienal |
| SMILES | Cn1nnnc1C(/C=C/C=O)=C(\c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15FN4O/c1-24-19(21-22-23-24)17(8-5-13-25)18(14-6-3-2-4-7-14)15-9-11-16(20)12-10-15/h2-13H,1H3/b8-5+,18-17+ |
| InChIKey | VDGAIWBTPXWGRK-RRCJXFLCSA-N |
| XLogP | 3.06 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|