About 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate
3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate (PubChem CID 14724207) has the molecular formula C14H24F2O4
and a molecular weight of 294.34 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate |
| PubChem CID | 14724207 |
| Molecular Formula | C14H24F2O4 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate |
| SMILES | CCOC(=O)C(CC(C)C)(C(=O)OC(C)(C)C)C(F)F |
| InChI | InChI=1S/C14H24F2O4/c1-7-19-11(17)14(10(15)16,8-9(2)3)12(18)20-13(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | RAHYJVANUDEUDR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate (CID 14724207) is 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate is CCOC(=O)C(CC(C)C)(C(=O)OC(C)(C)C)C(F)F.
What is the InChIKey of 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate?
The InChIKey is RAHYJVANUDEUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F2O4/c1-7-19-11(17)14(10(15)16,8-9(2)3)12(18)20-13(4,5)6/h9-10H,7-8H2,1-6H3.
What are the key properties of 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate?
3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate has a molecular weight of 294.34 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-ethyl 2-(difluoromethyl)-2-(2-methylpropyl)propanedioate is sourced from PubChem (CID 14724207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).