About 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone
1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone (PubChem CID 147242123) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone |
| PubChem CID | 147242123 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone |
| SMILES | CC(=O)N1CCN=C(C=CN)C1 |
| InChI | InChI=1S/C8H13N3O/c1-7(12)11-5-4-10-8(6-11)2-3-9/h2-3H,4-6,9H2,1H3 |
| InChIKey | WNSZPOGMAHJCRJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone?
The IUPAC name of 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone (CID 147242123) is 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone.
What is the SMILES notation for 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone?
The canonical SMILES for 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone is CC(=O)N1CCN=C(C=CN)C1.
What is the InChIKey of 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone?
The InChIKey is WNSZPOGMAHJCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-7(12)11-5-4-10-8(6-11)2-3-9/h2-3H,4-6,9H2,1H3.
What are the key properties of 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone?
1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone has a molecular weight of 167.21 g/mol, XLogP of -0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(2-aminoethenyl)-3,5-dihydro-2H-pyrazin-4-yl]ethanone is sourced from PubChem (CID 147242123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).