About 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea
1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea (PubChem CID 14724296) has the molecular formula C17H10Cl4N4O4S
and a molecular weight of 508.17 g/mol. Its IUPAC name is 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea.
Molecular Properties
| Compound Name | 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea |
| PubChem CID | 14724296 |
| Molecular Formula | C17H10Cl4N4O4S |
| Molecular Weight | 508.17 g/mol |
| Exact Mass | 505.92 |
| IUPAC Name | 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea |
| SMILES | O=C(Nc1nc(Cl)cc(Oc2ccc(Cl)cc2Cl)n1)NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H10Cl4N4O4S/c18-9-5-6-12(11(20)7-9)29-15-8-14(21)22-16(23-15)24-17(26)25-30(27,28)13-4-2-1-3-10(13)19/h1-8H,(H2,22,23,24,25,26) |
| InChIKey | XUMYFYMRTBBSSE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.17 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea?
The IUPAC name of 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea (CID 14724296) is 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea.
What is the SMILES notation for 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea?
The canonical SMILES for 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea is O=C(Nc1nc(Cl)cc(Oc2ccc(Cl)cc2Cl)n1)NS(=O)(=O)c1ccccc1Cl.
What is the InChIKey of 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea?
The InChIKey is XUMYFYMRTBBSSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl4N4O4S/c18-9-5-6-12(11(20)7-9)29-15-8-14(21)22-16(23-15)24-17(26)25-30(27,28)13-4-2-1-3-10(13)19/h1-8H,(H2,22,23,24,25,26).
What are the key properties of 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea?
1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea has a molecular weight of 508.17 g/mol, XLogP of 5.39, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-chloro-6-(2,4-dichlorophenoxy)pyrimidin-2-yl]-3-(2-chlorophenyl)sulfonylurea is sourced from PubChem (CID 14724296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).