C13H10N4OS — CID 147244081
6-indolizin-2-yl-2-methoxyimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 147244081) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 6-indolizin-2-yl-2-methoxyimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-indolizin-2-yl-2-methoxyimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 147244081 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 6-indolizin-2-yl-2-methoxyimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | COc1nn2cc(-c3cc4ccccn4c3)nc2s1 |
| InChI | InChI=1S/C13H10N4OS/c1-18-13-15-17-8-11(14-12(17)19-13)9-6-10-4-2-3-5-16(10)7-9/h2-8H,1H3 |
| InChIKey | CLIUNTYOUFSAPQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |