C18H29ClN7O9PS — CID 147245784
[2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methylsulfamoyl)propan-2-yl]phosphonic acid (PubChem CID 147245784) has the molecular formula C18H29ClN7O9PS and a molecular weight of 585.96 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methylsulfamoyl)propan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methylsulfamoyl)propan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 147245784 |
| Molecular Formula | C18H29ClN7O9PS |
| Molecular Weight | 585.96 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-(methylsulfamoyl)propan-2-yl]phosphonic acid |
| SMILES | CNS(=O)(=O)CC(C)(OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C18H29ClN7O9PS/c1-18(36(29,30)31,8-37(32,33)20-2)34-7-10-12(27)13(28)16(35-10)26-15-11(24-25-26)14(22-17(19)23-15)21-9-5-3-4-6-9/h9-10,12-13,16,20,27-28H,3-8H2,1-2H3,(H,21,22,23)(H2,29,30,31)/t10-,12-,13-,16-,18?/m1/s1 |
| InChIKey | CLQZRKAJJLLADS-CMAHQRSQSA-N |
| XLogP | -0.69 |
| TPSA | 231.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.96 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|