C18H7ClFN3O2 — CID 147249676
6-chloro-7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-2,10-dione (PubChem CID 147249676) has the molecular formula C18H7ClFN3O2 and a molecular weight of 351.72 g/mol. Its IUPAC name is 6-chloro-7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-2,10-dione.
| Compound Name | 6-chloro-7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-2,10-dione |
|---|---|
| PubChem CID | 147249676 |
| Molecular Formula | C18H7ClFN3O2 |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 6-chloro-7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4,6,8,11,13,15,17,19-nonaene-2,10-dione |
| SMILES | O=C1c2cc(F)c(Cl)cc2-n2c1nc1nc3ccccc3cc1c2=O |
| InChI | InChI=1S/C18H7ClFN3O2/c19-11-7-14-9(6-12(11)20)15(24)17-22-16-10(18(25)23(14)17)5-8-3-1-2-4-13(8)21-16/h1-7H |
| InChIKey | CMLACWPUXBUJNC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|