C28H24N2O3 — CID 1472510
4-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-propan-2-ylbenzamide (PubChem CID 1472510) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-propan-2-ylbenzamide.
| Compound Name | 4-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 1472510 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C28H24N2O3/c1-15(2)29-26(31)16-11-13-17(14-12-16)30-27(32)24-22-18-7-3-4-8-19(18)23(25(24)28(30)33)21-10-6-5-9-20(21)22/h3-15,22-25H,1-2H3,(H,29,31)/t22?,23?,24-,25+ |
| InChIKey | ITCMLVHUAKSTCM-XIGIHCPSSA-N |
| XLogP | 4.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|