C20H22BF2N3O2 — CID 147251656
3-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 147251656) has the molecular formula C20H22BF2N3O2 and a molecular weight of 385.22 g/mol. Its IUPAC name is 3-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 3-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 147251656 |
| Molecular Formula | C20H22BF2N3O2 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-(difluoromethyl)-2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | Cn1cc(-c2nc3cccc(B4OC(C)(C)C(C)(C)O4)c3cc2C(F)F)cn1 |
| InChI | InChI=1S/C20H22BF2N3O2/c1-19(2)20(3,4)28-21(27-19)15-7-6-8-16-13(15)9-14(18(22)23)17(25-16)12-10-24-26(5)11-12/h6-11,18H,1-5H3 |
| InChIKey | CMUREJYIMDTKLY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|