C25H37F2N3O7S — CID 147252424
N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-methylsulfonylethoxy)cyclohexyl]acetamide (PubChem CID 147252424) has the molecular formula C25H37F2N3O7S and a molecular weight of 561.65 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-methylsulfonylethoxy)cyclohexyl]acetamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-methylsulfonylethoxy)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 147252424 |
| Molecular Formula | C25H37F2N3O7S |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-isoindol-5-yl]methyl]-2,2-difluoro-2-[3-(2-methylsulfonylethoxy)cyclohexyl]acetamide |
| SMILES | CS(=O)(=O)CCOC1CCCC(C(F)(F)C(=O)NCC2CCC3C(=O)N(C4CCC(=O)NC4=O)CC3C2)C1 |
| InChI | InChI=1S/C25H37F2N3O7S/c1-38(35,36)10-9-37-18-4-2-3-17(12-18)25(26,27)24(34)28-13-15-5-6-19-16(11-15)14-30(23(19)33)20-7-8-21(31)29-22(20)32/h15-20H,2-14H2,1H3,(H,28,34)(H,29,31,32) |
| InChIKey | RTUNOHAWSJNFRO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|