About 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate
2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate (PubChem CID 147253282) has the molecular formula C13H19F2NO3
and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate.
Molecular Properties
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate |
| PubChem CID | 147253282 |
| Molecular Formula | C13H19F2NO3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate |
| SMILES | C=C(/C=C/C(=O)OCCN1CCC(F)(F)CC1)OC |
| InChI | InChI=1S/C13H19F2NO3/c1-11(18-2)3-4-12(17)19-10-9-16-7-5-13(14,15)6-8-16/h3-4H,1,5-10H2,2H3/b4-3+ |
| InChIKey | CNCIXZUOGZNYST-ONEGZZNKSA-N |
| XLogP | 1.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate?
The IUPAC name of 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate (CID 147253282) is 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate.
What is the SMILES notation for 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate?
The canonical SMILES for 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate is C=C(/C=C/C(=O)OCCN1CCC(F)(F)CC1)OC.
What is the InChIKey of 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate?
The InChIKey is CNCIXZUOGZNYST-ONEGZZNKSA-N. The full InChI is InChI=1S/C13H19F2NO3/c1-11(18-2)3-4-12(17)19-10-9-16-7-5-13(14,15)6-8-16/h3-4H,1,5-10H2,2H3/b4-3+.
What are the key properties of 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate?
2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate has a molecular weight of 275.30 g/mol, XLogP of 1.98, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluoropiperidin-1-yl)ethyl (2E)-4-methoxypenta-2,4-dienoate is sourced from PubChem (CID 147253282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).