C11H15BF3N2O2 — CID 147254181
CID 147254181 (PubChem CID 147254181) has the molecular formula C11H15BF3N2O2 and a molecular weight of 275.06 g/mol.
| Compound Name | CID 147254181 |
|---|---|
| PubChem CID | 147254181 |
| Molecular Formula | C11H15BF3N2O2 |
| Molecular Weight | 275.06 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H15BF3N2O2/c1-9(2,18)10(3,4)19-12-7-5-16-8(17-6-7)11(13,14)15/h5-6,18H,1-4H3 |
| InChIKey | KOBDCYXHOWNOPO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.06 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|