C18H26ClF3N4OS — CID 147254557
1-[4-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl-cyclohexylamino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 147254557) has the molecular formula C18H26ClF3N4OS and a molecular weight of 438.95 g/mol. Its IUPAC name is 1-[4-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl-cyclohexylamino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[4-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl-cyclohexylamino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 147254557 |
| Molecular Formula | C18H26ClF3N4OS |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-[4-[[(5-chloro-1,3-thiazol-2-yl)amino]methyl-cyclohexylamino]piperidin-1-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCC(N(CNc2ncc(Cl)s2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H26ClF3N4OS/c19-15-11-23-17(28-15)24-12-26(13-4-2-1-3-5-13)14-6-8-25(9-7-14)16(27)10-18(20,21)22/h11,13-14H,1-10,12H2,(H,23,24) |
| InChIKey | CNILONFUQWAPGD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|