C66H59B2F2N3O4 — CID 147255016
9-(2,6-diphenylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine (PubChem CID 147255016) has the molecular formula C66H59B2F2N3O4 and a molecular weight of 1017.84 g/mol. Its IUPAC name is 9-(2,6-diphenylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine.
| Compound Name | 9-(2,6-diphenylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 147255016 |
| Molecular Formula | C66H59B2F2N3O4 |
| Molecular Weight | 1017.84 g/mol |
| Exact Mass | 1017.47 |
| IUPAC Name | 9-(2,6-diphenylphenyl)-3-N,6-N-bis(4-fluorophenyl)-3-N,6-N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole-3,6-diamine |
| SMILES | CC1(C)OB(c2ccc(N(c3ccc(F)cc3)c3ccc4c(c3)c3cc(N(c5ccc(F)cc5)c5ccc(B6OC(C)(C)C(C)(C)O6)cc5)ccc3n4-c3c(-c4ccccc4)cccc3-c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C66H59B2F2N3O4/c1-63(2)64(3,4)75-67(74-63)46-22-30-50(31-23-46)71(52-34-26-48(69)27-35-52)54-38-40-60-58(42-54)59-43-55(72(53-36-28-49(70)29-37-53)51-32-24-47(25-33-51)68-76-65(5,6)66(7,8)77-68)39-41-61(59)73(60)62-56(44-16-11-9-12-17-44)20-15-21-57(62)45-18-13-10-14-19-45/h9-43H,1-8H3 |
| InChIKey | CNKWGOSJCWXDRW-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 48.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.84 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|