C21H24F3N5O5 — CID 147256542
tert-butyl 4-[10-(dihydroxyamino)-2-oxo-8-(trifluoromethyl)-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate (PubChem CID 147256542) has the molecular formula C21H24F3N5O5 and a molecular weight of 483.45 g/mol. Its IUPAC name is tert-butyl 4-[10-(dihydroxyamino)-2-oxo-8-(trifluoromethyl)-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[10-(dihydroxyamino)-2-oxo-8-(trifluoromethyl)-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 147256542 |
| Molecular Formula | C21H24F3N5O5 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | tert-butyl 4-[10-(dihydroxyamino)-2-oxo-8-(trifluoromethyl)-1H-pyrimido[1,2-b]indazol-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(=O)[nH]c3c4c(N(O)O)cc(C(F)(F)F)cc4nn23)CC1 |
| InChI | InChI=1S/C21H24F3N5O5/c1-20(2,3)34-19(31)27-6-4-11(5-7-27)14-10-16(30)25-18-17-13(26-28(14)18)8-12(21(22,23)24)9-15(17)29(32)33/h8-11,32-33H,4-7H2,1-3H3,(H,25,30) |
| InChIKey | CNSPCBPBWMSIOL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|