C19H26ClN3O2S — CID 147257308
tert-butyl N-[(4aR,7aS)-7a-(3-amino-5-chlorophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-N-methylcarbamate (PubChem CID 147257308) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is tert-butyl N-[(4aR,7aS)-7a-(3-amino-5-chlorophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(4aR,7aS)-7a-(3-amino-5-chlorophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 147257308 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | tert-butyl N-[(4aR,7aS)-7a-(3-amino-5-chlorophenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1=N[C@@]2(c3cc(N)cc(Cl)c3)CCC[C@H]2CS1 |
| InChI | InChI=1S/C19H26ClN3O2S/c1-18(2,3)25-17(24)23(4)16-22-19(7-5-6-12(19)11-26-16)13-8-14(20)10-15(21)9-13/h8-10,12H,5-7,11,21H2,1-4H3/t12-,19-/m0/s1 |
| InChIKey | CNWMESNZCXBBIA-BUXKBTBVSA-N |
| XLogP | 4.89 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|