C6H8O4S2 — CID 147259049
5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-thiol (PubChem CID 147259049) has the molecular formula C6H8O4S2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-thiol.
| Compound Name | 5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-thiol |
|---|---|
| PubChem CID | 147259049 |
| Molecular Formula | C6H8O4S2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-2-thiol |
| SMILES | O=S1(=O)OC2C(S)C3CC1C2O3 |
| InChI | InChI=1S/C6H8O4S2/c7-12(8)3-1-2-6(11)5(10-12)4(3)9-2/h2-6,11H,1H2 |
| InChIKey | GUIJZIGVYQLYIN-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|