C31H52O6Si — CID 14726113
[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-4-oxo-2,3,6,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 14726113) has the molecular formula C31H52O6Si and a molecular weight of 548.84 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-4-oxo-2,3,6,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-4-oxo-2,3,6,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 14726113 |
| Molecular Formula | C31H52O6Si |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-4-oxo-2,3,6,7,8,8a-hexahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C)C(=O)C2=CC[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C31H52O6Si/c1-11-31(7,8)29(34)36-25-16-20(3)28(33)24-14-12-19(2)23(27(24)25)15-13-21-17-22(18-26(32)35-21)37-38(9,10)30(4,5)6/h14,19-23,25,27H,11-13,15-18H2,1-10H3/t19-,20+,21+,22+,23-,25-,27+/m0/s1 |
| InChIKey | QHYQQVKGYVKUIU-DNKGLDCXSA-N |
| XLogP | 7.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|