C10H10N2O6 — CID 14726140
(3S,10R)-5,12-dioxa-1,8-diazatricyclo[8.4.0.03,8]tetradecane-4,6,11,13-tetrone (PubChem CID 14726140) has the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. Its IUPAC name is (3S,10R)-5,12-dioxa-1,8-diazatricyclo[8.4.0.03,8]tetradecane-4,6,11,13-tetrone.
| Compound Name | (3S,10R)-5,12-dioxa-1,8-diazatricyclo[8.4.0.03,8]tetradecane-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 14726140 |
| Molecular Formula | C10H10N2O6 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (3S,10R)-5,12-dioxa-1,8-diazatricyclo[8.4.0.03,8]tetradecane-4,6,11,13-tetrone |
| SMILES | O=C1CN2C[C@H]3C(=O)OC(=O)CN3C[C@@H]2C(=O)O1 |
| InChI | InChI=1S/C10H10N2O6/c13-7-3-11-1-5-9(15)17-8(14)4-12(5)2-6(11)10(16)18-7/h5-6H,1-4H2/t5-,6+ |
| InChIKey | NBMRSSCUQDDLEJ-OLQVQODUSA-N |
| XLogP | -2.49 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|