C13H18NO4S2- — CID 147261828
4-(ethylamino)-6-methyl-7,7-dioxo-1,1a,4,5,6,7b-hexahydrocyclopropa[h]thiochromene-2-sulfinate (PubChem CID 147261828) has the molecular formula C13H18NO4S2- and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(ethylamino)-6-methyl-7,7-dioxo-1,1a,4,5,6,7b-hexahydrocyclopropa[h]thiochromene-2-sulfinate.
| Compound Name | 4-(ethylamino)-6-methyl-7,7-dioxo-1,1a,4,5,6,7b-hexahydrocyclopropa[h]thiochromene-2-sulfinate |
|---|---|
| PubChem CID | 147261828 |
| Molecular Formula | C13H18NO4S2- |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-(ethylamino)-6-methyl-7,7-dioxo-1,1a,4,5,6,7b-hexahydrocyclopropa[h]thiochromene-2-sulfinate |
| SMILES | CCNC1CC(C)S(=O)(=O)C2=C1C=C(S(=O)[O-])C1CC21 |
| InChI | InChI=1S/C13H19NO4S2/c1-3-14-11-4-7(2)20(17,18)13-9-5-8(9)12(19(15)16)6-10(11)13/h6-9,11,14H,3-5H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | MVEWSSHNAHLMDE-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|