C27H27ClFNO — CID 147263671
(3S)-1-(4-chlorophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]hex-5-en-1-one (PubChem CID 147263671) has the molecular formula C27H27ClFNO and a molecular weight of 435.97 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]hex-5-en-1-one.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]hex-5-en-1-one |
|---|---|
| PubChem CID | 147263671 |
| Molecular Formula | C27H27ClFNO |
| Molecular Weight | 435.97 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]hex-5-en-1-one |
| SMILES | C=CC[C@@H](CC(=O)c1ccc(Cl)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C27H27ClFNO/c1-2-3-21(16-27(31)20-8-10-22(28)11-9-20)18-4-6-19(7-5-18)24-14-15-30-26-13-12-23(29)17-25(24)26/h2,8-15,17-19,21H,1,3-7,16H2/t18?,19?,21-/m0/s1 |
| InChIKey | CPBFYEOTHSCJRK-GRERDSQWSA-N |
| XLogP | 7.77 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.97 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|