C37H39BClFN4O6 — CID 147265050
tert-butyl 4-[2-[2-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-2-oxoethyl]benzoate (PubChem CID 147265050) has the molecular formula C37H39BClFN4O6 and a molecular weight of 701.00 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-2-oxoethyl]benzoate.
| Compound Name | tert-butyl 4-[2-[2-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-2-oxoethyl]benzoate |
|---|---|
| PubChem CID | 147265050 |
| Molecular Formula | C37H39BClFN4O6 |
| Molecular Weight | 701.00 g/mol |
| Exact Mass | 700.26 |
| IUPAC Name | tert-butyl 4-[2-[2-[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-1-yl]-2-oxoethyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CC(=O)C2c3cccc(B4OC(C)(C)C(C)(C)O4)c3CCN2C(=O)c2cn(-c3cccc(Cl)c3F)nn2)cc1 |
| InChI | InChI=1S/C37H39BClFN4O6/c1-35(2,3)48-34(47)23-16-14-22(15-17-23)20-30(45)32-25-10-8-11-26(38-49-36(4,5)37(6,7)50-38)24(25)18-19-43(32)33(46)28-21-44(42-41-28)29-13-9-12-27(39)31(29)40/h8-17,21,32H,18-20H2,1-7H3 |
| InChIKey | CPHXJBBFGPQVPY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 112.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.00 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|