About 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine
3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine (PubChem CID 1472656) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 1472656 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2ncc(S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C14H13N3O2S/c1-10-8-11(2)17-14(16-10)13(9-15-17)20(18,19)12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChIKey | DERQCQDVQZMDRO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine (CID 1472656) is 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine is Cc1cc(C)n2ncc(S(=O)(=O)c3ccccc3)c2n1.
What is the InChIKey of 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine?
The InChIKey is DERQCQDVQZMDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S/c1-10-8-11(2)17-14(16-10)13(9-15-17)20(18,19)12-6-4-3-5-7-12/h3-9H,1-2H3.
What are the key properties of 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine?
3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine has a molecular weight of 287.34 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 1472656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).