About 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one
1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one (PubChem CID 147265734) has the molecular formula C22H17F2NO2
and a molecular weight of 365.38 g/mol. Its IUPAC name is 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one.
Molecular Properties
| Compound Name | 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one |
| PubChem CID | 147265734 |
| Molecular Formula | C22H17F2NO2 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one |
| SMILES | CC(CC(=O)c1ccc2c(c1)OCc1cnccc1-2)c1c(F)cccc1F |
| InChI | InChI=1S/C22H17F2NO2/c1-13(22-18(23)3-2-4-19(22)24)9-20(26)14-5-6-17-16-7-8-25-11-15(16)12-27-21(17)10-14/h2-8,10-11,13H,9,12H2,1H3 |
| InChIKey | CPLCVTIYORFLHP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one?
The IUPAC name of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one (CID 147265734) is 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one.
What is the SMILES notation for 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one?
The canonical SMILES for 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one is CC(CC(=O)c1ccc2c(c1)OCc1cnccc1-2)c1c(F)cccc1F.
What is the InChIKey of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one?
The InChIKey is CPLCVTIYORFLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F2NO2/c1-13(22-18(23)3-2-4-19(22)24)9-20(26)14-5-6-17-16-7-8-25-11-15(16)12-27-21(17)10-14/h2-8,10-11,13H,9,12H2,1H3.
What are the key properties of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one?
1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one has a molecular weight of 365.38 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-(2,6-difluorophenyl)butan-1-one is sourced from PubChem (CID 147265734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).