About 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one
6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one (PubChem CID 147268105) has the molecular formula C7H7NO3S
and a molecular weight of 185.20 g/mol. Its IUPAC name is 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one |
| PubChem CID | 147268105 |
| Molecular Formula | C7H7NO3S |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one |
| SMILES | [H]/N=C1\C=C(S(C)(=O)=O)C=CC1=O |
| InChI | InChI=1S/C7H7NO3S/c1-12(10,11)5-2-3-7(9)6(8)4-5/h2-4,8H,1H3/b8-6+ |
| InChIKey | CPWPWDHJUOTHKC-SOFGYWHQSA-N |
| XLogP | 0.07 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one?
The IUPAC name of 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one (CID 147268105) is 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one is [H]/N=C1\C=C(S(C)(=O)=O)C=CC1=O.
What is the InChIKey of 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one?
The InChIKey is CPWPWDHJUOTHKC-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H7NO3S/c1-12(10,11)5-2-3-7(9)6(8)4-5/h2-4,8H,1H3/b8-6+.
What are the key properties of 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one?
6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one has a molecular weight of 185.20 g/mol, XLogP of 0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-4-methylsulfonylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 147268105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).