About 4,4-difluoro-1-methanidylpiperidine;scandium
4,4-difluoro-1-methanidylpiperidine;scandium (PubChem CID 147271375) has the molecular formula C6H10F2NSc-
and a molecular weight of 179.10 g/mol. Its IUPAC name is 4,4-difluoro-1-methanidylpiperidine;scandium.
Molecular Properties
| Compound Name | 4,4-difluoro-1-methanidylpiperidine;scandium |
| PubChem CID | 147271375 |
| Molecular Formula | C6H10F2NSc- |
| Molecular Weight | 179.10 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 4,4-difluoro-1-methanidylpiperidine;scandium |
| SMILES | [CH2-]N1CCC(F)(F)CC1.[Sc] |
| InChI | InChI=1S/C6H10F2N.Sc/c1-9-4-2-6(7,8)3-5-9;/h1-5H2;/q-1; |
| InChIKey | HRKORBABAOZSOT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.10 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-1-methanidylpiperidine;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-1-methanidylpiperidine;scandium?
The IUPAC name of 4,4-difluoro-1-methanidylpiperidine;scandium (CID 147271375) is 4,4-difluoro-1-methanidylpiperidine;scandium.
What is the SMILES notation for 4,4-difluoro-1-methanidylpiperidine;scandium?
The canonical SMILES for 4,4-difluoro-1-methanidylpiperidine;scandium is [CH2-]N1CCC(F)(F)CC1.[Sc].
What is the InChIKey of 4,4-difluoro-1-methanidylpiperidine;scandium?
The InChIKey is HRKORBABAOZSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N.Sc/c1-9-4-2-6(7,8)3-5-9;/h1-5H2;/q-1;.
What are the key properties of 4,4-difluoro-1-methanidylpiperidine;scandium?
4,4-difluoro-1-methanidylpiperidine;scandium has a molecular weight of 179.10 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1-methanidylpiperidine;scandium is sourced from PubChem (CID 147271375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).