C29H32F7NO6S — CID 147275809
[(3R)-3-[(4-fluorophenyl)sulfonylmethyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-[hydroxy(methoxy)methyl]cyclohexyl]methanone (PubChem CID 147275809) has the molecular formula C29H32F7NO6S and a molecular weight of 655.63 g/mol. Its IUPAC name is [(3R)-3-[(4-fluorophenyl)sulfonylmethyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-[hydroxy(methoxy)methyl]cyclohexyl]methanone.
| Compound Name | [(3R)-3-[(4-fluorophenyl)sulfonylmethyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-[hydroxy(methoxy)methyl]cyclohexyl]methanone |
|---|---|
| PubChem CID | 147275809 |
| Molecular Formula | C29H32F7NO6S |
| Molecular Weight | 655.63 g/mol |
| Exact Mass | 655.18 |
| IUPAC Name | [(3R)-3-[(4-fluorophenyl)sulfonylmethyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-[hydroxy(methoxy)methyl]cyclohexyl]methanone |
| SMILES | COC(O)C1CCC(C(=O)N2CC[C@@](CS(=O)(=O)c3ccc(F)cc3)(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)C2)CC1 |
| InChI | InChI=1S/C29H32F7NO6S/c1-43-25(39)19-4-2-18(3-5-19)24(38)37-15-14-26(16-37,17-44(41,42)23-12-10-22(30)11-13-23)20-6-8-21(9-7-20)27(40,28(31,32)33)29(34,35)36/h6-13,18-19,25,39-40H,2-5,14-17H2,1H3/t18?,19?,25?,26-/m1/s1 |
| InChIKey | CRIKSJWHLYJRKY-KJQSFYPXSA-N |
| XLogP | 4.85 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|