C34H31F2N4O3S3+ — CID 147277124
2-(3-(3-((5-(tert-butyl)thiophen-2-yl)ethynyl)-4-fluorophenyl)-5-(cyclopropylmethyl)-4-(3-fluoro-4-sulfamoylbenzyl)-1H-pyrazol-1-yl)thiazole-4-carboxylic acid (PubChem CID 147277124) has the molecular formula C34H31F2N4O3S3+ and a molecular weight of 677.84 g/mol.
| Compound Name | 2-(3-(3-((5-(tert-butyl)thiophen-2-yl)ethynyl)-4-fluorophenyl)-5-(cyclopropylmethyl)-4-(3-fluoro-4-sulfamoylbenzyl)-1H-pyrazol-1-yl)thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 147277124 |
| Molecular Formula | C34H31F2N4O3S3+ |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(C#Cc2cc(-c3nn(-c4nc(C(=O)O)cs4)c(CC4CC4)c3Cc3ccc([SH+](N)=O)c(F)c3)ccc2F)s1 |
| InChI | InChI=1S/C34H30F2N4O3S3/c1-34(2,3)30-13-10-23(45-30)9-7-21-17-22(8-11-25(21)35)31-24(14-20-6-12-29(46(37)43)26(36)15-20)28(16-19-4-5-19)40(39-31)33-38-27(18-44-33)32(41)42/h6,8,10-13,15,17-19H,4-5,14,16H2,1-3H3,(H2,37,43)(H,41,42)/p+1 |
| InChIKey | CROVTNZAFMJNGA-UHFFFAOYSA-O |
| XLogP | 7.20 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|