C26H36O4Si — CID 147277920
[(3aR,5S,6R,6aR)-6-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 147277920) has the molecular formula C26H36O4Si and a molecular weight of 440.66 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-6-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5S,6R,6aR)-6-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 147277920 |
| Molecular Formula | C26H36O4Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | [(3aR,5S,6R,6aR)-6-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O4Si/c1-7-21-22(28-24-23(21)29-26(5,6)30-24)18-27-31(25(2,3)4,19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17,21-24H,7,18H2,1-6H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | CRSLEPXRBHKODT-MOUTVQLLSA-N |
| XLogP | 4.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|