C9H5F6NO — CID 147283165
2-(1-azacyclohepta-2,4,6,7-tetraen-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 147283165) has the molecular formula C9H5F6NO and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-(1-azacyclohepta-2,4,6,7-tetraen-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(1-azacyclohepta-2,4,6,7-tetraen-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 147283165 |
| Molecular Formula | C9H5F6NO |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-(1-azacyclohepta-2,4,6,7-tetraen-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(C1=CC=C=NC=C1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F6NO/c10-8(11,12)7(17,9(13,14)15)6-2-1-4-16-5-3-6/h1-3,5,17H |
| InChIKey | CSSDOQKDOPLILJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |