C10H18O4S — CID 14728361
(3aR,4S,6R,7S,7aS)-2,2,4-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 14728361) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is (3aR,4S,6R,7S,7aS)-2,2,4-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,4S,6R,7S,7aS)-2,2,4-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 14728361 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (3aR,4S,6R,7S,7aS)-2,2,4-trimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CS[C@H]1O[C@@H](C)[C@H]2OC(C)(C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C10H18O4S/c1-5-7-8(14-10(2,3)13-7)6(11)9(12-5)15-4/h5-9,11H,1-4H3/t5-,6-,7+,8-,9+/m0/s1 |
| InChIKey | WFCLFOVDSZCCPH-VRGHQRLXSA-N |
| XLogP | 0.98 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |