C14H26O — CID 14728443
(7E,9E)-4,6,8-trimethylundeca-7,9-dien-5-ol (PubChem CID 14728443) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (7E,9E)-4,6,8-trimethylundeca-7,9-dien-5-ol.
| Compound Name | (7E,9E)-4,6,8-trimethylundeca-7,9-dien-5-ol |
|---|---|
| PubChem CID | 14728443 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (7E,9E)-4,6,8-trimethylundeca-7,9-dien-5-ol |
| SMILES | C/C=C/C(C)=C/C(C)C(O)C(C)CCC |
| InChI | InChI=1S/C14H26O/c1-6-8-11(3)10-13(5)14(15)12(4)9-7-2/h6,8,10,12-15H,7,9H2,1-5H3/b8-6+,11-10+ |
| InChIKey | TZAIZDJNSHBBJW-UMYLGFLZSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|