C9H11NO7 — CID 14728495
(2S)-2-[[(Z)-3-carboxyprop-2-enoyl]amino]pentanedioic acid (PubChem CID 14728495) has the molecular formula C9H11NO7 and a molecular weight of 245.19 g/mol. Its IUPAC name is (2S)-2-[[(Z)-3-carboxyprop-2-enoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(Z)-3-carboxyprop-2-enoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 14728495 |
| Molecular Formula | C9H11NO7 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (2S)-2-[[(Z)-3-carboxyprop-2-enoyl]amino]pentanedioic acid |
| SMILES | O=C(O)/C=C\C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H11NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h2,4-5H,1,3H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/b4-2-/t5-/m0/s1 |
| InChIKey | GEFVNCTULMSKRF-PSRSYCBASA-N |
| XLogP | -0.94 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|