About 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine
7-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 14728543) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 14728543 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1ccn2-c1ccccc1 |
| InChI | InChI=1S/C12H10N4/c13-11-10-6-7-16(12(10)15-8-14-11)9-4-2-1-3-5-9/h1-8H,(H2,13,14,15) |
| InChIKey | HSKDJAAEBMULSP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine (CID 14728543) is 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine is Nc1ncnc2c1ccn2-c1ccccc1.
What is the InChIKey of 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is HSKDJAAEBMULSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c13-11-10-6-7-16(12(10)15-8-14-11)9-4-2-1-3-5-9/h1-8H,(H2,13,14,15).
What are the key properties of 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
7-phenylpyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 210.24 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylpyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 14728543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).