C25H20F2N6O2 — CID 147289735
N-[(2R)-1-(6-azido-2-pyridinyl)-3-hydroxypropan-2-yl]-3-fluoro-2-[3-(4-fluorophenyl)-2H-pyrrol-5-yl]benzamide (PubChem CID 147289735) has the molecular formula C25H20F2N6O2 and a molecular weight of 474.47 g/mol. Its IUPAC name is N-[(2R)-1-(6-azido-2-pyridinyl)-3-hydroxypropan-2-yl]-3-fluoro-2-[3-(4-fluorophenyl)-2H-pyrrol-5-yl]benzamide.
| Compound Name | N-[(2R)-1-(6-azido-2-pyridinyl)-3-hydroxypropan-2-yl]-3-fluoro-2-[3-(4-fluorophenyl)-2H-pyrrol-5-yl]benzamide |
|---|---|
| PubChem CID | 147289735 |
| Molecular Formula | C25H20F2N6O2 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | N-[(2R)-1-(6-azido-2-pyridinyl)-3-hydroxypropan-2-yl]-3-fluoro-2-[3-(4-fluorophenyl)-2H-pyrrol-5-yl]benzamide |
| SMILES | [N-]=[N+]=Nc1cccc(C[C@H](CO)NC(=O)c2cccc(F)c2C2=NCC(c3ccc(F)cc3)=C2)n1 |
| InChI | InChI=1S/C25H20F2N6O2/c26-17-9-7-15(8-10-17)16-11-22(29-13-16)24-20(4-2-5-21(24)27)25(35)31-19(14-34)12-18-3-1-6-23(30-18)32-33-28/h1-11,19,34H,12-14H2,(H,31,35)/t19-/m1/s1 |
| InChIKey | CTYFJVTYPXYSOL-LJQANCHMSA-N |
| XLogP | 4.52 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|