C21H20O5 — CID 14729074
11-hydroxy-5-methoxy-2,2,9-trimethyl-3,4-dihydronaphtho[3,2-h]chromene-7,12-dione (PubChem CID 14729074) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 11-hydroxy-5-methoxy-2,2,9-trimethyl-3,4-dihydronaphtho[3,2-h]chromene-7,12-dione.
| Compound Name | 11-hydroxy-5-methoxy-2,2,9-trimethyl-3,4-dihydronaphtho[3,2-h]chromene-7,12-dione |
|---|---|
| PubChem CID | 14729074 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 11-hydroxy-5-methoxy-2,2,9-trimethyl-3,4-dihydronaphtho[3,2-h]chromene-7,12-dione |
| SMILES | COc1cc2c(c3c1CCC(C)(C)O3)C(=O)c1c(O)cc(C)cc1C2=O |
| InChI | InChI=1S/C21H20O5/c1-10-7-12-16(14(22)8-10)19(24)17-13(18(12)23)9-15(25-4)11-5-6-21(2,3)26-20(11)17/h7-9,22H,5-6H2,1-4H3 |
| InChIKey | YMAAIODFAUAYDO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|