About 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one
4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one (PubChem CID 1472913) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one |
| PubChem CID | 1472913 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C)c(=O)c1CCO |
| InChI | InChI=1S/C7H12N2O2/c1-5-6(3-4-10)7(11)9(2)8-5/h8,10H,3-4H2,1-2H3 |
| InChIKey | KAIKGPHUWGZNMW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one?
The IUPAC name of 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one (CID 1472913) is 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one.
What is the SMILES notation for 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one?
The canonical SMILES for 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one is Cc1[nH]n(C)c(=O)c1CCO.
What is the InChIKey of 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one?
The InChIKey is KAIKGPHUWGZNMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-5-6(3-4-10)7(11)9(2)8-5/h8,10H,3-4H2,1-2H3.
What are the key properties of 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one?
4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one has a molecular weight of 156.19 g/mol, XLogP of -0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethyl)-2,5-dimethyl-1H-pyrazol-3-one is sourced from PubChem (CID 1472913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).