C12H19NO3 — CID 14729156
methyl (3aS,7R,7aS)-7-(2-hydroxyethyl)-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate (PubChem CID 14729156) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is methyl (3aS,7R,7aS)-7-(2-hydroxyethyl)-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate.
| Compound Name | methyl (3aS,7R,7aS)-7-(2-hydroxyethyl)-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 14729156 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | methyl (3aS,7R,7aS)-7-(2-hydroxyethyl)-2,3,3a,4,7,7a-hexahydroindole-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H]2CC=C[C@@H](CCO)[C@H]21 |
| InChI | InChI=1S/C12H19NO3/c1-16-12(15)13-7-5-9-3-2-4-10(6-8-14)11(9)13/h2,4,9-11,14H,3,5-8H2,1H3/t9-,10-,11-/m0/s1 |
| InChIKey | CTVNYIMRKUXENR-DCAQKATOSA-N |
| XLogP | 1.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|